C10H15Br2NS — CID 171215563
(1R)-1-(4,5-dibromothiophen-2-yl)-4-methylpentan-1-amine (PubChem CID 171215563) has the molecular formula C10H15Br2NS and a molecular weight of 341.11 g/mol. Its IUPAC name is (1R)-1-(4,5-dibromothiophen-2-yl)-4-methylpentan-1-amine.
| Compound Name | (1R)-1-(4,5-dibromothiophen-2-yl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 171215563 |
| Molecular Formula | C10H15Br2NS |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | (1R)-1-(4,5-dibromothiophen-2-yl)-4-methylpentan-1-amine |
| SMILES | CC(C)CC[C@@H](N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H15Br2NS/c1-6(2)3-4-8(13)9-5-7(11)10(12)14-9/h5-6,8H,3-4,13H2,1-2H3/t8-/m1/s1 |
| InChIKey | GEHLKESDBGGEKE-MRVPVSSYSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |