C7H9Br2NO2S2 — CID 130055149
(1S)-1-(4,5-dibromothiophen-2-yl)-2-methylsulfonylethanamine (PubChem CID 130055149) has the molecular formula C7H9Br2NO2S2 and a molecular weight of 363.10 g/mol. Its IUPAC name is (1S)-1-(4,5-dibromothiophen-2-yl)-2-methylsulfonylethanamine.
| Compound Name | (1S)-1-(4,5-dibromothiophen-2-yl)-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 130055149 |
| Molecular Formula | C7H9Br2NO2S2 |
| Molecular Weight | 363.10 g/mol |
| Exact Mass | 360.84 |
| IUPAC Name | (1S)-1-(4,5-dibromothiophen-2-yl)-2-methylsulfonylethanamine |
| SMILES | CS(=O)(=O)C[C@H](N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H9Br2NO2S2/c1-14(11,12)3-5(10)6-2-4(8)7(9)13-6/h2,5H,3,10H2,1H3/t5-/m0/s1 |
| InChIKey | CXLBPTHDUDCYLR-YFKPBYRVSA-N |
| XLogP | 2.32 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.10 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |