C9H13Br2NS — CID 171235173
(1S)-1-(4,5-dibromothiophen-2-yl)pentan-1-amine (PubChem CID 171235173) has the molecular formula C9H13Br2NS and a molecular weight of 327.09 g/mol. Its IUPAC name is (1S)-1-(4,5-dibromothiophen-2-yl)pentan-1-amine.
| Compound Name | (1S)-1-(4,5-dibromothiophen-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 171235173 |
| Molecular Formula | C9H13Br2NS |
| Molecular Weight | 327.09 g/mol |
| Exact Mass | 324.91 |
| IUPAC Name | (1S)-1-(4,5-dibromothiophen-2-yl)pentan-1-amine |
| SMILES | CCCC[C@H](N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H13Br2NS/c1-2-3-4-7(12)8-5-6(10)9(11)13-8/h5,7H,2-4,12H2,1H3/t7-/m0/s1 |
| InChIKey | NHPJRUXQLLTIHH-ZETCQYMHSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.09 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |