C12H19Br2NS — CID 82985514
1-(4,5-dibromothiophen-2-yl)-2-propylpentan-1-amine (PubChem CID 82985514) has the molecular formula C12H19Br2NS and a molecular weight of 369.17 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-propylpentan-1-amine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 82985514 |
| Molecular Formula | C12H19Br2NS |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-propylpentan-1-amine |
| SMILES | CCCC(CCC)C(N)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H19Br2NS/c1-3-5-8(6-4-2)11(15)10-7-9(13)12(14)16-10/h7-8,11H,3-6,15H2,1-2H3 |
| InChIKey | OUOPRCBZDQLFTG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |