C11H16Br2OS — CID 114753442
1-(4,5-dibromothiophen-2-yl)heptan-1-ol (PubChem CID 114753442) has the molecular formula C11H16Br2OS and a molecular weight of 356.12 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)heptan-1-ol.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)heptan-1-ol |
|---|---|
| PubChem CID | 114753442 |
| Molecular Formula | C11H16Br2OS |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)heptan-1-ol |
| SMILES | CCCCCCC(O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H16Br2OS/c1-2-3-4-5-6-9(14)10-7-8(12)11(13)15-10/h7,9,14H,2-6H2,1H3 |
| InChIKey | VLANWRWHXSNUOM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|