About 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol
3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol (PubChem CID 80538163) has the molecular formula C7H9Br2NOS
and a molecular weight of 315.03 g/mol. Its IUPAC name is 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol |
| PubChem CID | 80538163 |
| Molecular Formula | C7H9Br2NOS |
| Molecular Weight | 315.03 g/mol |
| Exact Mass | 312.88 |
| IUPAC Name | 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol |
| SMILES | NCCC(O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H9Br2NOS/c8-4-3-6(12-7(4)9)5(11)1-2-10/h3,5,11H,1-2,10H2 |
| InChIKey | AKRJHYSTDVUVTO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.03 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol?
The IUPAC name of 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol (CID 80538163) is 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol.
What is the SMILES notation for 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol?
The canonical SMILES for 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol is NCCC(O)c1cc(Br)c(Br)s1.
What is the InChIKey of 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol?
The InChIKey is AKRJHYSTDVUVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Br2NOS/c8-4-3-6(12-7(4)9)5(11)1-2-10/h3,5,11H,1-2,10H2.
What are the key properties of 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol?
3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol has a molecular weight of 315.03 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(4,5-dibromothiophen-2-yl)propan-1-ol is sourced from PubChem (CID 80538163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).