2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid

C8H8Br2O4S — CID 80535278

IUPAC2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid
SMILESO=C(O)COCC(O)c1cc(Br)c(Br)s1
InChIInChI=1S/C8H8Br2O4S/c9-4-1-6(15-8(4)10)5(11)2-14-3-7(12)13/h1,5,11H,2-3H2,(H,12,13)
InChIKeyNBARSQITXNWBEY-UHFFFAOYSA-N
MW360.02 g/mol
LogP2.41
Rot. Bonds5

About 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid

2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid (PubChem CID 80535278) has the molecular formula C8H8Br2O4S and a molecular weight of 360.02 g/mol. Its IUPAC name is 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid
PubChem CID80535278
Molecular FormulaC8H8Br2O4S
Molecular Weight360.02 g/mol
Exact Mass357.85
IUPAC Name2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid
SMILESO=C(O)COCC(O)c1cc(Br)c(Br)s1
InChIInChI=1S/C8H8Br2O4S/c9-4-1-6(15-8(4)10)5(11)2-14-3-7(12)13/h1,5,11H,2-3H2,(H,12,13)
InChIKeyNBARSQITXNWBEY-UHFFFAOYSA-N
XLogP2.41
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.02
LogP ≤ 52.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid?
The IUPAC name of 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid (CID 80535278) is 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid.
What is the SMILES notation for 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid?
The canonical SMILES for 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid is O=C(O)COCC(O)c1cc(Br)c(Br)s1.
What is the InChIKey of 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid?
The InChIKey is NBARSQITXNWBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2O4S/c9-4-1-6(15-8(4)10)5(11)2-14-3-7(12)13/h1,5,11H,2-3H2,(H,12,13).
What are the key properties of 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid?
2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid has a molecular weight of 360.02 g/mol, XLogP of 2.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,5-dibromothiophen-2-yl)-2-hydroxyethoxy]acetic acid is sourced from PubChem (CID 80535278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).