C10H8Cl4O4 — CID 105349698
2-[2-hydroxy-2-(2,3,4,6-tetrachlorophenyl)ethoxy]acetic acid (PubChem CID 105349698) has the molecular formula C10H8Cl4O4 and a molecular weight of 333.98 g/mol. Its IUPAC name is 2-[2-hydroxy-2-(2,3,4,6-tetrachlorophenyl)ethoxy]acetic acid.
| Compound Name | 2-[2-hydroxy-2-(2,3,4,6-tetrachlorophenyl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 105349698 |
| Molecular Formula | C10H8Cl4O4 |
| Molecular Weight | 333.98 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 2-[2-hydroxy-2-(2,3,4,6-tetrachlorophenyl)ethoxy]acetic acid |
| SMILES | O=C(O)COCC(O)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl4O4/c11-4-1-5(12)9(13)10(14)8(4)6(15)2-18-3-7(16)17/h1,6,15H,2-3H2,(H,16,17) |
| InChIKey | SWBLVJHDFYKYIL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.98 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|