C13H14Cl4O3 — CID 105349697
5-hydroxy-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid (PubChem CID 105349697) has the molecular formula C13H14Cl4O3 and a molecular weight of 360.06 g/mol. Its IUPAC name is 5-hydroxy-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid.
| Compound Name | 5-hydroxy-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 105349697 |
| Molecular Formula | C13H14Cl4O3 |
| Molecular Weight | 360.06 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 5-hydroxy-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(O)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl4O3/c1-13(2,5-9(19)20)4-8(18)10-6(14)3-7(15)11(16)12(10)17/h3,8,18H,4-5H2,1-2H3,(H,19,20) |
| InChIKey | BBHZFDLRKAMMMH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|