C13H12Cl4F2O2 — CID 105349667
5,5-difluoro-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid (PubChem CID 105349667) has the molecular formula C13H12Cl4F2O2 and a molecular weight of 380.05 g/mol. Its IUPAC name is 5,5-difluoro-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid.
| Compound Name | 5,5-difluoro-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 105349667 |
| Molecular Formula | C13H12Cl4F2O2 |
| Molecular Weight | 380.05 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 5,5-difluoro-3,3-dimethyl-5-(2,3,4,6-tetrachlorophenyl)pentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(F)(F)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl4F2O2/c1-12(2,4-8(20)21)5-13(18,19)9-6(14)3-7(15)10(16)11(9)17/h3H,4-5H2,1-2H3,(H,20,21) |
| InChIKey | XZNPAUTZTNFGDH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.05 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|