C11H12Cl4O — CID 105350487
3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-ol (PubChem CID 105350487) has the molecular formula C11H12Cl4O and a molecular weight of 302.03 g/mol. Its IUPAC name is 3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-ol.
| Compound Name | 3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 105350487 |
| Molecular Formula | C11H12Cl4O |
| Molecular Weight | 302.03 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-ol |
| SMILES | CC(C)(CCO)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl4O/c1-11(2,3-4-16)8-6(12)5-7(13)9(14)10(8)15/h5,16H,3-4H2,1-2H3 |
| InChIKey | UDIRYOWOXRMJHO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|