C11H13Cl4N — CID 105350479
3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-amine (PubChem CID 105350479) has the molecular formula C11H13Cl4N and a molecular weight of 301.04 g/mol. Its IUPAC name is 3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-amine.
| Compound Name | 3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 105350479 |
| Molecular Formula | C11H13Cl4N |
| Molecular Weight | 301.04 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 3-methyl-3-(2,3,4,6-tetrachlorophenyl)butan-1-amine |
| SMILES | CC(C)(CCN)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl4N/c1-11(2,3-4-16)8-6(12)5-7(13)9(14)10(8)15/h5H,3-4,16H2,1-2H3 |
| InChIKey | MGELBNLRZFYHPI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.04 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|