C14H20Cl3N — CID 105350472
3-methyl-N-propyl-3-(2,4,6-trichlorophenyl)butan-1-amine (PubChem CID 105350472) has the molecular formula C14H20Cl3N and a molecular weight of 308.68 g/mol. Its IUPAC name is 3-methyl-N-propyl-3-(2,4,6-trichlorophenyl)butan-1-amine.
| Compound Name | 3-methyl-N-propyl-3-(2,4,6-trichlorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 105350472 |
| Molecular Formula | C14H20Cl3N |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-methyl-N-propyl-3-(2,4,6-trichlorophenyl)butan-1-amine |
| SMILES | CCCNCCC(C)(C)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl3N/c1-4-6-18-7-5-14(2,3)13-11(16)8-10(15)9-12(13)17/h8-9,18H,4-7H2,1-3H3 |
| InChIKey | OTFLPMADNPKIGH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|