C19H33N — CID 79830467
3-methyl-3-(2,3,4,5,6-pentamethylphenyl)-N-propylbutan-1-amine (PubChem CID 79830467) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 3-methyl-3-(2,3,4,5,6-pentamethylphenyl)-N-propylbutan-1-amine.
| Compound Name | 3-methyl-3-(2,3,4,5,6-pentamethylphenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79830467 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 3-methyl-3-(2,3,4,5,6-pentamethylphenyl)-N-propylbutan-1-amine |
| SMILES | CCCNCCC(C)(C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C19H33N/c1-9-11-20-12-10-19(7,8)18-16(5)14(3)13(2)15(4)17(18)6/h20H,9-12H2,1-8H3 |
| InChIKey | FNIJTGHCOPSJBT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|