C14H21F2N — CID 81023408
3-(3,5-difluorophenyl)-3-methyl-N-propylbutan-1-amine (PubChem CID 81023408) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-3-methyl-N-propylbutan-1-amine.
| Compound Name | 3-(3,5-difluorophenyl)-3-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 81023408 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-(3,5-difluorophenyl)-3-methyl-N-propylbutan-1-amine |
| SMILES | CCCNCCC(C)(C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H21F2N/c1-4-6-17-7-5-14(2,3)11-8-12(15)10-13(16)9-11/h8-10,17H,4-7H2,1-3H3 |
| InChIKey | BDVHSCZDNHQKFA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|