C12H17F2N — CID 64504664
3-(3,5-difluorophenyl)-N-propylpropan-1-amine (PubChem CID 64504664) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-propylpropan-1-amine.
| Compound Name | 3-(3,5-difluorophenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 64504664 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-propylpropan-1-amine |
| SMILES | CCCNCCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2N/c1-2-5-15-6-3-4-10-7-11(13)9-12(14)8-10/h7-9,15H,2-6H2,1H3 |
| InChIKey | OMFQTWCXZZGLEU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|