C10H13F3 — CID 143588669
1,3-difluoro-5-propylbenzene;fluoromethane (PubChem CID 143588669) has the molecular formula C10H13F3 and a molecular weight of 190.21 g/mol. Its IUPAC name is 1,3-difluoro-5-propylbenzene;fluoromethane.
| Compound Name | 1,3-difluoro-5-propylbenzene;fluoromethane |
|---|---|
| PubChem CID | 143588669 |
| Molecular Formula | C10H13F3 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1,3-difluoro-5-propylbenzene;fluoromethane |
| SMILES | CCCc1cc(F)cc(F)c1.CF |
| InChI | InChI=1S/C9H10F2.CH3F/c1-2-3-7-4-8(10)6-9(11)5-7;1-2/h4-6H,2-3H2,1H3;1H3 |
| InChIKey | YVVFKWKVJUDVDZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |