C15H23F2N — CID 105409696
1-(3,5-difluorophenyl)-N-ethylheptan-4-amine (PubChem CID 105409696) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-ethylheptan-4-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-ethylheptan-4-amine |
|---|---|
| PubChem CID | 105409696 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-ethylheptan-4-amine |
| SMILES | CCCC(CCCc1cc(F)cc(F)c1)NCC |
| InChI | InChI=1S/C15H23F2N/c1-3-6-15(18-4-2)8-5-7-12-9-13(16)11-14(17)10-12/h9-11,15,18H,3-8H2,1-2H3 |
| InChIKey | JAANTPPMXXRCHH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |