About N-[(3,5-difluorophenyl)methyl]octan-4-amine
N-[(3,5-difluorophenyl)methyl]octan-4-amine (PubChem CID 106023055) has the molecular formula C15H23F2N
and a molecular weight of 255.35 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]octan-4-amine.
Molecular Properties
| Compound Name | N-[(3,5-difluorophenyl)methyl]octan-4-amine |
| PubChem CID | 106023055 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]octan-4-amine |
| SMILES | CCCCC(CCC)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H23F2N/c1-3-5-7-15(6-4-2)18-11-12-8-13(16)10-14(17)9-12/h8-10,15,18H,3-7,11H2,1-2H3 |
| InChIKey | PLQTWIBRIAWYLH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3,5-difluorophenyl)methyl]octan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-difluorophenyl)methyl]octan-4-amine?
The IUPAC name of N-[(3,5-difluorophenyl)methyl]octan-4-amine (CID 106023055) is N-[(3,5-difluorophenyl)methyl]octan-4-amine.
What is the SMILES notation for N-[(3,5-difluorophenyl)methyl]octan-4-amine?
The canonical SMILES for N-[(3,5-difluorophenyl)methyl]octan-4-amine is CCCCC(CCC)NCc1cc(F)cc(F)c1.
What is the InChIKey of N-[(3,5-difluorophenyl)methyl]octan-4-amine?
The InChIKey is PLQTWIBRIAWYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N/c1-3-5-7-15(6-4-2)18-11-12-8-13(16)10-14(17)9-12/h8-10,15,18H,3-7,11H2,1-2H3.
What are the key properties of N-[(3,5-difluorophenyl)methyl]octan-4-amine?
N-[(3,5-difluorophenyl)methyl]octan-4-amine has a molecular weight of 255.35 g/mol, XLogP of 4.41, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-difluorophenyl)methyl]octan-4-amine is sourced from PubChem (CID 106023055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).