C9H13F2N — CID 154650973
1-ethyl-3,5-difluorobenzene;methanamine (PubChem CID 154650973) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is 1-ethyl-3,5-difluorobenzene;methanamine.
| Compound Name | 1-ethyl-3,5-difluorobenzene;methanamine |
|---|---|
| PubChem CID | 154650973 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 1-ethyl-3,5-difluorobenzene;methanamine |
| SMILES | CCc1cc(F)cc(F)c1.CN |
| InChI | InChI=1S/C8H8F2.CH5N/c1-2-6-3-7(9)5-8(10)4-6;1-2/h3-5H,2H2,1H3;2H2,1H3 |
| InChIKey | CZAAKWPFLABADG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |