C13H8F4 — CID 54036374
1-[(3,5-difluorophenyl)methyl]-3,5-difluorobenzene (PubChem CID 54036374) has the molecular formula C13H8F4 and a molecular weight of 240.20 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3,5-difluorobenzene.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 54036374 |
| Molecular Formula | C13H8F4 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C13H8F4/c14-10-2-8(3-11(15)6-10)1-9-4-12(16)7-13(17)5-9/h2-7H,1H2 |
| InChIKey | HZFFNHTUWCSZGY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |