C16H16F2 — CID 150549971
2-[(3,5-difluorophenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 150549971) has the molecular formula C16H16F2 and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 150549971 |
| Molecular Formula | C16H16F2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(Cc2cc(F)cc(F)c2)c(C)c1 |
| InChI | InChI=1S/C16H16F2/c1-10-4-11(2)16(12(3)5-10)8-13-6-14(17)9-15(18)7-13/h4-7,9H,8H2,1-3H3 |
| InChIKey | IHRAHTJNGGUPTH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |