C16H31F — CID 170736558
ethane;2-ethyl-1-fluoro-3,5-dimethylbenzene (PubChem CID 170736558) has the molecular formula C16H31F and a molecular weight of 242.42 g/mol. Its IUPAC name is ethane;2-ethyl-1-fluoro-3,5-dimethylbenzene.
| Compound Name | ethane;2-ethyl-1-fluoro-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 170736558 |
| Molecular Formula | C16H31F |
| Molecular Weight | 242.42 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | ethane;2-ethyl-1-fluoro-3,5-dimethylbenzene |
| SMILES | CC.CC.CC.CCc1c(C)cc(C)cc1F |
| InChI | InChI=1S/C10H13F.3C2H6/c1-4-9-8(3)5-7(2)6-10(9)11;3*1-2/h5-6H,4H2,1-3H3;3*1-2H3 |
| InChIKey | JSTKGLSMTBTFLG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |