C9H10FI — CID 170736464
1-fluoro-2-(iodomethyl)-3,5-dimethylbenzene (PubChem CID 170736464) has the molecular formula C9H10FI and a molecular weight of 264.08 g/mol. Its IUPAC name is 1-fluoro-2-(iodomethyl)-3,5-dimethylbenzene.
| Compound Name | 1-fluoro-2-(iodomethyl)-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 170736464 |
| Molecular Formula | C9H10FI |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 1-fluoro-2-(iodomethyl)-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)c(CI)c(F)c1 |
| InChI | InChI=1S/C9H10FI/c1-6-3-7(2)8(5-11)9(10)4-6/h3-4H,5H2,1-2H3 |
| InChIKey | YPQOQMKXYWFECJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|