About 2-(chloromethyl)-1,3,5-trimethylbenzene;methane
2-(chloromethyl)-1,3,5-trimethylbenzene;methane (PubChem CID 158287443) has the molecular formula C11H17Cl
and a molecular weight of 184.71 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3,5-trimethylbenzene;methane.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1,3,5-trimethylbenzene;methane |
| PubChem CID | 158287443 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(chloromethyl)-1,3,5-trimethylbenzene;methane |
| SMILES | C.Cc1cc(C)c(CCl)c(C)c1 |
| InChI | InChI=1S/C10H13Cl.CH4/c1-7-4-8(2)10(6-11)9(3)5-7;/h4-5H,6H2,1-3H3;1H4 |
| InChIKey | GKYIVTRXXLOFQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1,3,5-trimethylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1,3,5-trimethylbenzene;methane?
The IUPAC name of 2-(chloromethyl)-1,3,5-trimethylbenzene;methane (CID 158287443) is 2-(chloromethyl)-1,3,5-trimethylbenzene;methane.
What is the SMILES notation for 2-(chloromethyl)-1,3,5-trimethylbenzene;methane?
The canonical SMILES for 2-(chloromethyl)-1,3,5-trimethylbenzene;methane is C.Cc1cc(C)c(CCl)c(C)c1.
What is the InChIKey of 2-(chloromethyl)-1,3,5-trimethylbenzene;methane?
The InChIKey is GKYIVTRXXLOFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.CH4/c1-7-4-8(2)10(6-11)9(3)5-7;/h4-5H,6H2,1-3H3;1H4.
What are the key properties of 2-(chloromethyl)-1,3,5-trimethylbenzene;methane?
2-(chloromethyl)-1,3,5-trimethylbenzene;methane has a molecular weight of 184.71 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1,3,5-trimethylbenzene;methane is sourced from PubChem (CID 158287443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).