C11H17Cl — CID 158287443
2-(chloromethyl)-1,3,5-trimethylbenzene;methane (PubChem CID 158287443) has the molecular formula C11H17Cl and a molecular weight of 184.71 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3,5-trimethylbenzene;methane.
| Compound Name | 2-(chloromethyl)-1,3,5-trimethylbenzene;methane |
|---|---|
| PubChem CID | 158287443 |
| Molecular Formula | C11H17Cl |
| Molecular Weight | 184.71 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(chloromethyl)-1,3,5-trimethylbenzene;methane |
| SMILES | C.Cc1cc(C)c(CCl)c(C)c1 |
| InChI | InChI=1S/C10H13Cl.CH4/c1-7-4-8(2)10(6-11)9(3)5-7;/h4-5H,6H2,1-3H3;1H4 |
| InChIKey | GKYIVTRXXLOFQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|