About trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide
trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide (PubChem CID 63701991) has the molecular formula C10H13BF3-
and a molecular weight of 201.02 g/mol. Its IUPAC name is trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide.
Molecular Properties
| Compound Name | trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide |
| PubChem CID | 63701991 |
| Molecular Formula | C10H13BF3- |
| Molecular Weight | 201.02 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide |
| SMILES | Cc1cc(C)c(C[B-](F)(F)F)c(C)c1 |
| InChI | InChI=1S/C10H13BF3/c1-7-4-8(2)10(9(3)5-7)6-11(12,13)14/h4-5H,6H2,1-3H3/q-1 |
| InChIKey | GXWWJAAGHPBLCE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.02 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide?
The IUPAC name of trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide (CID 63701991) is trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide.
What is the SMILES notation for trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide?
The canonical SMILES for trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide is Cc1cc(C)c(C[B-](F)(F)F)c(C)c1.
What is the InChIKey of trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide?
The InChIKey is GXWWJAAGHPBLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BF3/c1-7-4-8(2)10(9(3)5-7)6-11(12,13)14/h4-5H,6H2,1-3H3/q-1.
What are the key properties of trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide?
trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide has a molecular weight of 201.02 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide is sourced from PubChem (CID 63701991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).