C10H13BF3- — CID 63701991
trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide (PubChem CID 63701991) has the molecular formula C10H13BF3- and a molecular weight of 201.02 g/mol. Its IUPAC name is trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide.
| Compound Name | trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide |
|---|---|
| PubChem CID | 63701991 |
| Molecular Formula | C10H13BF3- |
| Molecular Weight | 201.02 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | trifluoro-[(2,4,6-trimethylphenyl)methyl]boranuide |
| SMILES | Cc1cc(C)c(C[B-](F)(F)F)c(C)c1 |
| InChI | InChI=1S/C10H13BF3/c1-7-4-8(2)10(9(3)5-7)6-11(12,13)14/h4-5H,6H2,1-3H3/q-1 |
| InChIKey | GXWWJAAGHPBLCE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.02 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|