potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide

C10H13BF3KO — CID 63705472

IUPACpotassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide
SMILESCc1cc(C)c(OC[B-](F)(F)F)c(C)c1.[K+]
InChIInChI=1S/C10H13BF3O.K/c1-7-4-8(2)10(9(3)5-7)15-6-11(12,13)14;/h4-5H,6H2,1-3H3;/q-1;+1
InChIKeyQVRDVCOLZKZEOK-UHFFFAOYSA-N
MW256.12 g/mol
LogP0.38
Rot. Bonds3

About potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide

potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide (PubChem CID 63705472) has the molecular formula C10H13BF3KO and a molecular weight of 256.12 g/mol. Its IUPAC name is potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide.

Molecular Properties

Compound Namepotassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide
PubChem CID63705472
Molecular FormulaC10H13BF3KO
Molecular Weight256.12 g/mol
Exact Mass256.06
IUPAC Namepotassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide
SMILESCc1cc(C)c(OC[B-](F)(F)F)c(C)c1.[K+]
InChIInChI=1S/C10H13BF3O.K/c1-7-4-8(2)10(9(3)5-7)15-6-11(12,13)14;/h4-5H,6H2,1-3H3;/q-1;+1
InChIKeyQVRDVCOLZKZEOK-UHFFFAOYSA-N
XLogP0.38
TPSA9.23 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.12
LogP ≤ 50.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide?
The IUPAC name of potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide (CID 63705472) is potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide.
What is the SMILES notation for potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide?
The canonical SMILES for potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide is Cc1cc(C)c(OC[B-](F)(F)F)c(C)c1.[K+].
What is the InChIKey of potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide?
The InChIKey is QVRDVCOLZKZEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BF3O.K/c1-7-4-8(2)10(9(3)5-7)15-6-11(12,13)14;/h4-5H,6H2,1-3H3;/q-1;+1.
What are the key properties of potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide?
potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide has a molecular weight of 256.12 g/mol, XLogP of 0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide is sourced from PubChem (CID 63705472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).