C10H13BF3KO — CID 63705472
potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide (PubChem CID 63705472) has the molecular formula C10H13BF3KO and a molecular weight of 256.12 g/mol. Its IUPAC name is potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide.
| Compound Name | potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide |
|---|---|
| PubChem CID | 63705472 |
| Molecular Formula | C10H13BF3KO |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | potassium trifluoro-[(2,4,6-trimethylphenoxy)methyl]boranuide |
| SMILES | Cc1cc(C)c(OC[B-](F)(F)F)c(C)c1.[K+] |
| InChI | InChI=1S/C10H13BF3O.K/c1-7-4-8(2)10(9(3)5-7)15-6-11(12,13)14;/h4-5H,6H2,1-3H3;/q-1;+1 |
| InChIKey | QVRDVCOLZKZEOK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|