C21H28O3 — CID 121215502
1,3-bis(2,4,6-trimethylphenoxy)propan-2-ol (PubChem CID 121215502) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenoxy)propan-2-ol.
| Compound Name | 1,3-bis(2,4,6-trimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 121215502 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(C)c(OCC(O)COc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H28O3/c1-13-7-15(3)20(16(4)8-13)23-11-19(22)12-24-21-17(5)9-14(2)10-18(21)6/h7-10,19,22H,11-12H2,1-6H3 |
| InChIKey | QAMIBKBKPRWTHA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |