C19H24O2 — CID 63467021
1-(4-ethylphenyl)-2-(2,4,6-trimethylphenoxy)ethanol (PubChem CID 63467021) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2,4,6-trimethylphenoxy)ethanol.
| Compound Name | 1-(4-ethylphenyl)-2-(2,4,6-trimethylphenoxy)ethanol |
|---|---|
| PubChem CID | 63467021 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2,4,6-trimethylphenoxy)ethanol |
| SMILES | CCc1ccc(C(O)COc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H24O2/c1-5-16-6-8-17(9-7-16)18(20)12-21-19-14(3)10-13(2)11-15(19)4/h6-11,18,20H,5,12H2,1-4H3 |
| InChIKey | HVYMPOGLNGZETB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |