C15H25NO — CID 61220683
3,3-dimethyl-1-(2,4,6-trimethylphenoxy)butan-2-amine (PubChem CID 61220683) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2,4,6-trimethylphenoxy)butan-2-amine.
| Compound Name | 3,3-dimethyl-1-(2,4,6-trimethylphenoxy)butan-2-amine |
|---|---|
| PubChem CID | 61220683 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3,3-dimethyl-1-(2,4,6-trimethylphenoxy)butan-2-amine |
| SMILES | Cc1cc(C)c(OCC(N)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H25NO/c1-10-7-11(2)14(12(3)8-10)17-9-13(16)15(4,5)6/h7-8,13H,9,16H2,1-6H3 |
| InChIKey | XONNJSLBIBHYTN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |