C18H23NO2 — CID 61220878
1-(2-methoxyphenyl)-2-(2,4,6-trimethylphenoxy)ethanamine (PubChem CID 61220878) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-(2,4,6-trimethylphenoxy)ethanamine.
| Compound Name | 1-(2-methoxyphenyl)-2-(2,4,6-trimethylphenoxy)ethanamine |
|---|---|
| PubChem CID | 61220878 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-(2,4,6-trimethylphenoxy)ethanamine |
| SMILES | COc1ccccc1C(N)COc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H23NO2/c1-12-9-13(2)18(14(3)10-12)21-11-16(19)15-7-5-6-8-17(15)20-4/h5-10,16H,11,19H2,1-4H3 |
| InChIKey | OBZIEIZWRNMYAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |