C9H14N2O — CID 51699599
(1S)-1-(2-methoxyphenyl)ethane-1,2-diamine (PubChem CID 51699599) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S)-1-(2-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 51699599 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (1S)-1-(2-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccccc1[C@H](N)CN |
| InChI | InChI=1S/C9H14N2O/c1-12-9-5-3-2-4-7(9)8(11)6-10/h2-5,8H,6,10-11H2,1H3/t8-/m1/s1 |
| InChIKey | XUBNIEXLYZKEQM-MRVPVSSYSA-N |
| XLogP | 0.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |