C10H16N2O2 — CID 22756535
1-(2,6-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 22756535) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2,6-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22756535 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cccc(OC)c1C(N)CN |
| InChI | InChI=1S/C10H16N2O2/c1-13-8-4-3-5-9(14-2)10(8)7(12)6-11/h3-5,7H,6,11-12H2,1-2H3 |
| InChIKey | OEFZNWLHWVRJJG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |