C11H19ClN2O3 — CID 171201024
(1S)-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 171201024) has the molecular formula C11H19ClN2O3 and a molecular weight of 262.74 g/mol. Its IUPAC name is (1S)-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1S)-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 171201024 |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (1S)-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1cc(OC)c([C@H](N)CN)c(OC)c1.Cl |
| InChI | InChI=1S/C11H18N2O3.ClH/c1-14-7-4-9(15-2)11(8(13)6-12)10(5-7)16-3;/h4-5,8H,6,12-13H2,1-3H3;1H/t8-;/m1./s1 |
| InChIKey | NZNHFUGOOWVOAK-DDWIOCJRSA-N |
| XLogP | 1.09 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |