C10H17ClN2O3 — CID 171207071
2-[(1S)-1,2-diaminoethyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171207071) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-[(1S)-1,2-diaminoethyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1S)-1,2-diaminoethyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171207071 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-[(1S)-1,2-diaminoethyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@H](N)CN)c(OC)c1.Cl |
| InChI | InChI=1S/C10H16N2O3.ClH/c1-14-6-3-8(13)10(7(12)5-11)9(4-6)15-2;/h3-4,7,13H,5,11-12H2,1-2H3;1H/t7-;/m1./s1 |
| InChIKey | TUYWRHSTTFDORO-OGFXRTJISA-N |
| XLogP | 0.79 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|