C13H23ClN2O3 — CID 171226651
2-[(1S)-1,5-diaminopentyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171226651) has the molecular formula C13H23ClN2O3 and a molecular weight of 290.79 g/mol. Its IUPAC name is 2-[(1S)-1,5-diaminopentyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1S)-1,5-diaminopentyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171226651 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[(1S)-1,5-diaminopentyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@@H](N)CCCCN)c(OC)c1.Cl |
| InChI | InChI=1S/C13H22N2O3.ClH/c1-17-9-7-11(16)13(12(8-9)18-2)10(15)5-3-4-6-14;/h7-8,10,16H,3-6,14-15H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | XPQNWSLBAYZCCF-PPHPATTJSA-N |
| XLogP | 1.96 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|