C12H18F2N2O — CID 171235409
(1S)-1-(2,6-difluoro-4-methoxyphenyl)pentane-1,5-diamine (PubChem CID 171235409) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is (1S)-1-(2,6-difluoro-4-methoxyphenyl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(2,6-difluoro-4-methoxyphenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171235409 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (1S)-1-(2,6-difluoro-4-methoxyphenyl)pentane-1,5-diamine |
| SMILES | COc1cc(F)c([C@@H](N)CCCCN)c(F)c1 |
| InChI | InChI=1S/C12H18F2N2O/c1-17-8-6-9(13)12(10(14)7-8)11(16)4-2-3-5-15/h6-7,11H,2-5,15-16H2,1H3/t11-/m0/s1 |
| InChIKey | KZUDURHBPIRIEQ-NSHDSACASA-N |
| XLogP | 2.10 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|