C13H20ClF2NO — CID 171215785
(1R)-1-(2,6-difluoro-4-methoxyphenyl)hexan-1-amine;hydrochloride (PubChem CID 171215785) has the molecular formula C13H20ClF2NO and a molecular weight of 279.76 g/mol. Its IUPAC name is (1R)-1-(2,6-difluoro-4-methoxyphenyl)hexan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,6-difluoro-4-methoxyphenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171215785 |
| Molecular Formula | C13H20ClF2NO |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (1R)-1-(2,6-difluoro-4-methoxyphenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@@H](N)c1c(F)cc(OC)cc1F.Cl |
| InChI | InChI=1S/C13H19F2NO.ClH/c1-3-4-5-6-12(16)13-10(14)7-9(17-2)8-11(13)15;/h7-8,12H,3-6,16H2,1-2H3;1H/t12-;/m1./s1 |
| InChIKey | VZTSSUSBMUGXIW-UTONKHPSSA-N |
| XLogP | 3.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|