C12H17ClF3N — CID 171224460
(1S)-1-(2,4,6-trifluorophenyl)hexan-1-amine;hydrochloride (PubChem CID 171224460) has the molecular formula C12H17ClF3N and a molecular weight of 267.72 g/mol. Its IUPAC name is (1S)-1-(2,4,6-trifluorophenyl)hexan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,4,6-trifluorophenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171224460 |
| Molecular Formula | C12H17ClF3N |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (1S)-1-(2,4,6-trifluorophenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@H](N)c1c(F)cc(F)cc1F.Cl |
| InChI | InChI=1S/C12H16F3N.ClH/c1-2-3-4-5-11(16)12-9(14)6-8(13)7-10(12)15;/h6-7,11H,2-5,16H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | HHOFMZPGOMRRET-MERQFXBCSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|