C13H20ClF2N — CID 171229559
(1S)-1-(2,6-difluoro-3-methylphenyl)hexan-1-amine;hydrochloride (PubChem CID 171229559) has the molecular formula C13H20ClF2N and a molecular weight of 263.76 g/mol. Its IUPAC name is (1S)-1-(2,6-difluoro-3-methylphenyl)hexan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,6-difluoro-3-methylphenyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171229559 |
| Molecular Formula | C13H20ClF2N |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (1S)-1-(2,6-difluoro-3-methylphenyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC[C@H](N)c1c(F)ccc(C)c1F.Cl |
| InChI | InChI=1S/C13H19F2N.ClH/c1-3-4-5-6-11(16)12-10(14)8-7-9(2)13(12)15;/h7-8,11H,3-6,16H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | AUAGFHBKZROIPZ-MERQFXBCSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|