C12H19ClF2N2 — CID 171229550
(1S)-1-(2,6-difluoro-3-methylphenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171229550) has the molecular formula C12H19ClF2N2 and a molecular weight of 264.75 g/mol. Its IUPAC name is (1S)-1-(2,6-difluoro-3-methylphenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-(2,6-difluoro-3-methylphenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171229550 |
| Molecular Formula | C12H19ClF2N2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1S)-1-(2,6-difluoro-3-methylphenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cc1ccc(F)c([C@@H](N)CCCCN)c1F.Cl |
| InChI | InChI=1S/C12H18F2N2.ClH/c1-8-5-6-9(13)11(12(8)14)10(16)4-2-3-7-15;/h5-6,10H,2-4,7,15-16H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | QKNNWERSYFHICQ-PPHPATTJSA-N |
| XLogP | 2.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|