C11H15F3N2 — CID 171205092
(1R)-1-(2,3,6-trifluorophenyl)pentane-1,5-diamine (PubChem CID 171205092) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is (1R)-1-(2,3,6-trifluorophenyl)pentane-1,5-diamine.
| Compound Name | (1R)-1-(2,3,6-trifluorophenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171205092 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (1R)-1-(2,3,6-trifluorophenyl)pentane-1,5-diamine |
| SMILES | NCCCC[C@@H](N)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C11H15F3N2/c12-7-4-5-8(13)11(14)10(7)9(16)3-1-2-6-15/h4-5,9H,1-3,6,15-16H2/t9-/m1/s1 |
| InChIKey | NSAHALGRALHWJJ-SECBINFHSA-N |
| XLogP | 2.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|