C11H16F2N2O — CID 171215718
(1R)-1-(2,6-difluoro-3-methoxyphenyl)butane-1,4-diamine (PubChem CID 171215718) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is (1R)-1-(2,6-difluoro-3-methoxyphenyl)butane-1,4-diamine.
| Compound Name | (1R)-1-(2,6-difluoro-3-methoxyphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171215718 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (1R)-1-(2,6-difluoro-3-methoxyphenyl)butane-1,4-diamine |
| SMILES | COc1ccc(F)c([C@H](N)CCCN)c1F |
| InChI | InChI=1S/C11H16F2N2O/c1-16-9-5-4-7(12)10(11(9)13)8(15)3-2-6-14/h4-5,8H,2-3,6,14-15H2,1H3/t8-/m1/s1 |
| InChIKey | ICCSWJNNPNUPNF-MRVPVSSYSA-N |
| XLogP | 1.71 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |