C9H11F2NO — CID 55272050
1-(2,6-difluoro-3-methoxyphenyl)ethanamine (PubChem CID 55272050) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methoxyphenyl)ethanamine.
| Compound Name | 1-(2,6-difluoro-3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 55272050 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-(2,6-difluoro-3-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(F)c(C(C)N)c1F |
| InChI | InChI=1S/C9H11F2NO/c1-5(12)8-6(10)3-4-7(13-2)9(8)11/h3-5H,12H2,1-2H3 |
| InChIKey | VCZOLTWZQZKGTD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |