C12H16ClF2NO — CID 171215754
(1R)-1-(2,6-difluoro-3-methoxyphenyl)pent-4-en-1-amine;hydrochloride (PubChem CID 171215754) has the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. Its IUPAC name is (1R)-1-(2,6-difluoro-3-methoxyphenyl)pent-4-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,6-difluoro-3-methoxyphenyl)pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171215754 |
| Molecular Formula | C12H16ClF2NO |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (1R)-1-(2,6-difluoro-3-methoxyphenyl)pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1c(F)ccc(OC)c1F.Cl |
| InChI | InChI=1S/C12H15F2NO.ClH/c1-3-4-5-9(15)11-8(13)6-7-10(16-2)12(11)14;/h3,6-7,9H,1,4-5,15H2,2H3;1H/t9-;/m1./s1 |
| InChIKey | PWOLOGJYILHANU-SBSPUUFOSA-N |
| XLogP | 3.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|