C9H11F2N — CID 55283283
1-(2,6-difluoro-3-methylphenyl)ethanamine (PubChem CID 55283283) has the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)ethanamine.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 55283283 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)ethanamine |
| SMILES | Cc1ccc(F)c(C(C)N)c1F |
| InChI | InChI=1S/C9H11F2N/c1-5-3-4-7(10)8(6(2)12)9(5)11/h3-4,6H,12H2,1-2H3 |
| InChIKey | BQMQHQLWIVKOLZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |