C10H8F7N — CID 171311822
(1S)-1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 171311822) has the molecular formula C10H8F7N and a molecular weight of 275.17 g/mol. Its IUPAC name is (1S)-1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | (1S)-1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 171311822 |
| Molecular Formula | C10H8F7N |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (1S)-1-(2,6-difluoro-3-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | Cc1ccc(F)c([C@H](N)C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C10H8F7N/c1-4-2-3-5(11)6(7(4)12)8(18)9(13,14)10(15,16)17/h2-3,8H,18H2,1H3/t8-/m0/s1 |
| InChIKey | GCPHOQGYDUHVOU-QMMMGPOBSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|