C10H10ClF6N — CID 171312332
(1R)-2,2,3,3,3-pentafluoro-1-(3-fluoro-4-methylphenyl)propan-1-amine;hydrochloride (PubChem CID 171312332) has the molecular formula C10H10ClF6N and a molecular weight of 293.64 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(3-fluoro-4-methylphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(3-fluoro-4-methylphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312332 |
| Molecular Formula | C10H10ClF6N |
| Molecular Weight | 293.64 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(3-fluoro-4-methylphenyl)propan-1-amine;hydrochloride |
| SMILES | Cc1ccc([C@@H](N)C(F)(F)C(F)(F)F)cc1F.Cl |
| InChI | InChI=1S/C10H9F6N.ClH/c1-5-2-3-6(4-7(5)11)8(17)9(12,13)10(14,15)16;/h2-4,8H,17H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | SJAUJEDKIMMZLX-DDWIOCJRSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|