C10H11ClF5NS — CID 171311910
(1S)-2,2,3,3,3-pentafluoro-1-(4-methylsulfanylphenyl)propan-1-amine;hydrochloride (PubChem CID 171311910) has the molecular formula C10H11ClF5NS and a molecular weight of 307.72 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(4-methylsulfanylphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(4-methylsulfanylphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311910 |
| Molecular Formula | C10H11ClF5NS |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(4-methylsulfanylphenyl)propan-1-amine;hydrochloride |
| SMILES | CSc1ccc([C@H](N)C(F)(F)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C10H10F5NS.ClH/c1-17-7-4-2-6(3-5-7)8(16)9(11,12)10(13,14)15;/h2-5,8H,16H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | GZFFVIAUZKATTL-QRPNPIFTSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|