C15H14F3NS — CID 115852240
(4-methylsulfanylphenyl)-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 115852240) has the molecular formula C15H14F3NS and a molecular weight of 297.35 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (4-methylsulfanylphenyl)-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 115852240 |
| Molecular Formula | C15H14F3NS |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (4-methylsulfanylphenyl)-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CSc1ccc(C(N)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H14F3NS/c1-20-13-8-4-11(5-9-13)14(19)10-2-6-12(7-3-10)15(16,17)18/h2-9,14H,19H2,1H3 |
| InChIKey | IRXFBPHINWDXOF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |